Table of Contents
What is a Tetrabromide?
: a bromide containing four atoms of bromine.
How do you write carbon tetrabromide?
Carbon tetrabromide | CBr4 – PubChem.
What is the chemical name for B2Br4?
Identification of Tetrabromo-1,2-diboraethane Chemical Compound
| Chemical Formula | B2Br4 |
|---|---|
| Molecular Weight | 341.238 g/mol |
| IUPAC Name | 1,1,2,2-tetrabromodiborane |
| SMILES String | BrB(Br)B(Br)Br |
| InChI | InChI=1S/B2Br4/c3-1(4)2(5)6 |
What is cbr2 in chemistry?
Carbon tetrabromide
| Names | |
|---|---|
| show InChI | |
| show SMILES | |
| Properties | |
| Chemical formula | CBr4 |
What is the formula for the binary molecular compound diphosphorus trioxide?
P2 O3
The formula for diphosphorus trioxide is P2 O3. The ”di” in diphosphorus means two phosphorus atoms are present. The ”tri” in trioxide means…
What is P4O6 called?
Phosphorus trioxide is the chemical compound with the molecular formula P4O6. Although the molecular formula suggests the name tetraphosphorus hexoxide, the name phosphorus trioxide preceded the knowledge of the compound’s molecular structure, and its usage continues today.
What is a hydrate formula?
Formula of a Hydrate (Anhydrous Solid⋅xH2O) In order to determine the formula of the hydrate, [Anhydrous Solid⋅xH2O], the number of moles of water per mole of anhydrous solid (x) will be calculated by dividing the number of moles of water by the number of moles of the anhydrous solid (Equation 2.12. 6).
What is the formula for Disulfur Decafluoride?
S2F10
Disulfur decafluoride/Formula
What is the formula for nitrogen trifluoride?
NF3
Nitrogen trifluoride/Formula
What is the chemical formula of diphosphorus pentoxide?
P₂O₅
Phosphorus pentoxide/Formula
Hint: The chemical formula for diphosphorus pentoxide is P2O5 which is its empirical formula. The actual formula is P4O10 which has an adamantane (cage-like) structure. Diphosphorus pentoxide is also simply known as ‘Phosphorus pentoxide’.
What is the molar mass of CBr4?
Formula: CBr4. Molar Mass: 331.627 g/mol 1g=3.01543601697087E-03 mol. Percent composition (by mass): Element count Atom Mass %(by mass) C 1 12.011 3.62%.
What is the molecular geometry of carbon tetra bromide?
The molecular geometry of carbon tetra bromide is tetrahedral . It would have electron geometry trigonal planar, and a molecular geometry of Bent. Asked in Chemistry What is the molecular geometry of OCl2? It is Linear. The lone pairs in the Lewis Structure are not factors in molecular geometry.
What is the name of the compound CBr4?
The name for compound given by Martije is CBr4 (carbon tetrabromide). It stands that is one C and four Br atoms in the molecule.
What is the molecular geometry of CBr4?
If you look at the Lewis Structure for CBr4 it appears to be a symmetrical molecule. However, to determine if CBr4 is polar we consider the molecular geometry. A polar molecule results from an unequal/unsymmetrical sharing of valence electrons.